C22H22N2O4S — CID 9156766
N-[(2R)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methylbenzamide (PubChem CID 9156766) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methylbenzamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 9156766 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)[C@@H](CNC(=O)c2ccc(C)cc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-16-5-7-17(8-6-16)22(25)24-15-21(18-4-3-13-23-14-18)29(26,27)20-11-9-19(28-2)10-12-20/h3-14,21H,15H2,1-2H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | PPVZORSHOOXKHW-NRFANRHFSA-N |
| XLogP | 3.34 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |