C17H19ClN2O3S — CID 9154652
3-chloro-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide (PubChem CID 9154652) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-chloro-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide.
| Compound Name | 3-chloro-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 9154652 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-chloro-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CNC(=O)CCCl)c2cccnc2)cc1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-13-4-6-15(7-5-13)24(22,23)16(12-20-17(21)8-9-18)14-3-2-10-19-11-14/h2-7,10-11,16H,8-9,12H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | NUBDPPBPBQFGEV-MRXNPFEDSA-N |
| XLogP | 2.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|