C18H21ClN2O3S — CID 9157472
3-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide (PubChem CID 9157472) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide.
| Compound Name | 3-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 9157472 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)CCCl)c2cccnc2)cc1C |
| InChI | InChI=1S/C18H21ClN2O3S/c1-13-5-6-16(10-14(13)2)25(23,24)17(12-21-18(22)7-8-19)15-4-3-9-20-11-15/h3-6,9-11,17H,7-8,12H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | NHYRQUWQKBQTSP-KRWDZBQOSA-N |
| XLogP | 2.96 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|