C24H24N2O3S — CID 9157609
(E)-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylprop-2-enamide (PubChem CID 9157609) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9157609 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (E)-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)/C=C/c2ccccc2)c2cccnc2)cc1C |
| InChI | InChI=1S/C24H24N2O3S/c1-18-10-12-22(15-19(18)2)30(28,29)23(21-9-6-14-25-16-21)17-26-24(27)13-11-20-7-4-3-5-8-20/h3-16,23H,17H2,1-2H3,(H,26,27)/b13-11+/t23-/m0/s1 |
| InChIKey | GEQDZLURHAKSMH-BWSGXRDBSA-N |
| XLogP | 4.04 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|