C17H19ClN2O3S — CID 9157462
2-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]acetamide (PubChem CID 9157462) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]acetamide.
| Compound Name | 2-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 9157462 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-chloro-N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)CCl)c2cccnc2)cc1C |
| InChI | InChI=1S/C17H19ClN2O3S/c1-12-5-6-15(8-13(12)2)24(22,23)16(11-20-17(21)9-18)14-4-3-7-19-10-14/h3-8,10,16H,9,11H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | XCJYJGUXVPVAMT-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|