C22H21FN2O3S — CID 9157535
N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-fluorobenzamide (PubChem CID 9157535) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-fluorobenzamide.
| Compound Name | N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 9157535 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[(2R)-2-(3,4-dimethylphenyl)sulfonyl-2-pyridin-3-ylethyl]-3-fluorobenzamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)c2cccc(F)c2)c2cccnc2)cc1C |
| InChI | InChI=1S/C22H21FN2O3S/c1-15-8-9-20(11-16(15)2)29(27,28)21(18-6-4-10-24-13-18)14-25-22(26)17-5-3-7-19(23)12-17/h3-13,21H,14H2,1-2H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | ITJASJVATUEXJW-NRFANRHFSA-N |
| XLogP | 3.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |