C14H18Cl2N2O3S — CID 20982708
2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethanamine;dihydrochloride (PubChem CID 20982708) has the molecular formula C14H18Cl2N2O3S and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethanamine;dihydrochloride.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 20982708 |
| Molecular Formula | C14H18Cl2N2O3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethanamine;dihydrochloride |
| SMILES | COc1ccc(S(=O)(=O)C(CN)c2cccnc2)cc1.Cl.Cl |
| InChI | InChI=1S/C14H16N2O3S.2ClH/c1-19-12-4-6-13(7-5-12)20(17,18)14(9-15)11-3-2-8-16-10-11;;/h2-8,10,14H,9,15H2,1H3;2*1H |
| InChIKey | KPACMIXQEYYWCD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |