C18H24N2O5S2 — CID 9156583
N-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide (PubChem CID 9156583) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide.
| Compound Name | N-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 9156583 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24N2O5S2/c1-3-4-12-26(21,22)20-14-18(15-6-5-11-19-13-15)27(23,24)17-9-7-16(25-2)8-10-17/h5-11,13,18,20H,3-4,12,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | PNYWMNYUDDCFFO-GOSISDBHSA-N |
| XLogP | 2.32 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |