C18H23FN2O4S2 — CID 21007653
N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide (PubChem CID 21007653) has the molecular formula C18H23FN2O4S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 21007653 |
| Molecular Formula | C18H23FN2O4S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC(c1cccnc1)S(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C18H23FN2O4S2/c1-3-4-10-26(22,23)21-13-18(15-6-5-9-20-12-15)27(24,25)16-7-8-17(19)14(2)11-16/h5-9,11-12,18,21H,3-4,10,13H2,1-2H3 |
| InChIKey | OIXGXCVRBDZOOV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |