C22H23ClN2O4S2 — CID 42272396
N-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylpropane-1-sulfonamide (PubChem CID 42272396) has the molecular formula C22H23ClN2O4S2 and a molecular weight of 479.02 g/mol. Its IUPAC name is N-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylpropane-1-sulfonamide.
| Compound Name | N-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 42272396 |
| Molecular Formula | C22H23ClN2O4S2 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-3-phenylpropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCc1ccccc1)NC[C@@H](c1cccnc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O4S2/c23-20-10-12-21(13-11-20)31(28,29)22(19-9-4-14-24-16-19)17-25-30(26,27)15-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-14,16,22,25H,5,8,15,17H2/t22-/m0/s1 |
| InChIKey | MJQWPBDFYHBAFR-QFIPXVFZSA-N |
| XLogP | 3.80 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |