C15H18N2O4S2 — CID 9153010
N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]ethanesulfonamide (PubChem CID 9153010) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]ethanesulfonamide.
| Compound Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 9153010 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-2-22(18,19)17-12-15(13-7-6-10-16-11-13)23(20,21)14-8-4-3-5-9-14/h3-11,15,17H,2,12H2,1H3/t15-/m1/s1 |
| InChIKey | XTIOLRPAXQMYIY-OAHLLOKOSA-N |
| XLogP | 1.54 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |