C17H21ClN2O4S2 — CID 9156197
N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide (PubChem CID 9156197) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide.
| Compound Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 9156197 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-2-3-11-25(21,22)20-13-17(14-5-4-10-19-12-14)26(23,24)16-8-6-15(18)7-9-16/h4-10,12,17,20H,2-3,11,13H2,1H3/t17-/m1/s1 |
| InChIKey | PCIAIFFJQOFAOF-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |