C21H21ClN2O4S2 — CID 21002129
N-[2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-2-phenylethanesulfonamide (PubChem CID 21002129) has the molecular formula C21H21ClN2O4S2 and a molecular weight of 465.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 21002129 |
| Molecular Formula | C21H21ClN2O4S2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-2-phenylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCC(c1cccnc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S2/c22-19-8-10-20(11-9-19)30(27,28)21(18-7-4-13-23-15-18)16-24-29(25,26)14-12-17-5-2-1-3-6-17/h1-11,13,15,21,24H,12,14,16H2 |
| InChIKey | IGDXJNSNDPVJCN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |