C13H16N2O4S3 — CID 9151636
N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]ethanesulfonamide (PubChem CID 9151636) has the molecular formula C13H16N2O4S3 and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]ethanesulfonamide.
| Compound Name | N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 9151636 |
| Molecular Formula | C13H16N2O4S3 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H](c1cccnc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H16N2O4S3/c1-2-21(16,17)15-10-12(11-5-3-7-14-9-11)22(18,19)13-6-4-8-20-13/h3-9,12,15H,2,10H2,1H3/t12-/m0/s1 |
| InChIKey | RROVMPSMSMLHLY-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |