C16H16N2O4S4 — CID 40903625
5-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-sulfonamide (PubChem CID 40903625) has the molecular formula C16H16N2O4S4 and a molecular weight of 428.58 g/mol. Its IUPAC name is 5-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40903625 |
| Molecular Formula | C16H16N2O4S4 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 5-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H](c2cccnc2)S(=O)(=O)c2cccs2)s1 |
| InChI | InChI=1S/C16H16N2O4S4/c1-12-6-7-16(24-12)26(21,22)18-11-14(13-4-2-8-17-10-13)25(19,20)15-5-3-9-23-15/h2-10,14,18H,11H2,1H3/t14-/m0/s1 |
| InChIKey | YDXRMKNSRVPAJR-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |