C18H16N2O3S2 — CID 21001981
N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzamide (PubChem CID 21001981) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzamide.
| Compound Name | N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 21001981 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzamide |
| SMILES | O=C(NCC(c1cccnc1)S(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3S2/c21-18(14-6-2-1-3-7-14)20-13-16(15-8-4-10-19-12-15)25(22,23)17-9-5-11-24-17/h1-12,16H,13H2,(H,20,21) |
| InChIKey | HWPBHPXWZIAQMI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |