C16H14N2O3S3 — CID 9151978
N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide (PubChem CID 9151978) has the molecular formula C16H14N2O3S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9151978 |
| Molecular Formula | C16H14N2O3S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](c1cccnc1)S(=O)(=O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H14N2O3S3/c19-16(13-5-2-8-22-13)18-11-14(12-4-1-7-17-10-12)24(20,21)15-6-3-9-23-15/h1-10,14H,11H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | LQLAYDFTZAODBO-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |