C17H14ClNO3S3 — CID 9184130
N-[(2R)-2-(4-chlorophenyl)-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide (PubChem CID 9184130) has the molecular formula C17H14ClNO3S3 and a molecular weight of 411.96 g/mol. Its IUPAC name is N-[(2R)-2-(4-chlorophenyl)-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(2R)-2-(4-chlorophenyl)-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9184130 |
| Molecular Formula | C17H14ClNO3S3 |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | N-[(2R)-2-(4-chlorophenyl)-2-thiophen-2-ylsulfonylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(Cl)cc1)S(=O)(=O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H14ClNO3S3/c18-13-7-5-12(6-8-13)15(25(21,22)16-4-2-10-24-16)11-19-17(20)14-3-1-9-23-14/h1-10,15H,11H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | FFSMXCRLDRBJAR-HNNXBMFYSA-N |
| XLogP | 4.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |