C17H14ClNO4S2 — CID 7268351
4-chloro-N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzamide (PubChem CID 7268351) has the molecular formula C17H14ClNO4S2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzamide.
| Compound Name | 4-chloro-N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzamide |
|---|---|
| PubChem CID | 7268351 |
| Molecular Formula | C17H14ClNO4S2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 4-chloro-N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzamide |
| SMILES | O=C(NC[C@@H](c1ccco1)S(=O)(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO4S2/c18-13-7-5-12(6-8-13)17(20)19-11-15(14-3-1-9-23-14)25(21,22)16-4-2-10-24-16/h1-10,15H,11H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | HSVXSXQCEVVEIL-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |