C15H16N2O5S2 — CID 22584668
N'-cyclopropyl-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide (PubChem CID 22584668) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N'-cyclopropyl-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide |
|---|---|
| PubChem CID | 22584668 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N'-cyclopropyl-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]oxamide |
| SMILES | O=C(NCC(c1ccco1)S(=O)(=O)c1cccs1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H16N2O5S2/c18-14(15(19)17-10-5-6-10)16-9-12(11-3-1-7-22-11)24(20,21)13-4-2-8-23-13/h1-4,7-8,10,12H,5-6,9H2,(H,16,18)(H,17,19) |
| InChIKey | ODHBZOTYCGYSQD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|