C14H17NO4S2 — CID 7268311
N-[(2R)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]butanamide (PubChem CID 7268311) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]butanamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]butanamide |
|---|---|
| PubChem CID | 7268311 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]butanamide |
| SMILES | CCCC(=O)NC[C@H](c1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H17NO4S2/c1-2-5-13(16)15-10-12(11-6-3-8-19-11)21(17,18)14-7-4-9-20-14/h3-4,6-9,12H,2,5,10H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | XXFNUIVEUFYSBH-GFCCVEGCSA-N |
| XLogP | 2.77 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |