C11H17NO3 — CID 99876283
N-[(2S)-2-(furan-2-yl)-2-methoxyethyl]butanamide (PubChem CID 99876283) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-methoxyethyl]butanamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-methoxyethyl]butanamide |
|---|---|
| PubChem CID | 99876283 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-methoxyethyl]butanamide |
| SMILES | CCCC(=O)NC[C@H](OC)c1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-3-5-11(13)12-8-10(14-2)9-6-4-7-15-9/h4,6-7,10H,3,5,8H2,1-2H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | BPXGBHSHNYRAMX-JTQLQIEISA-N |
| XLogP | 1.88 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |