C9H13NO4 — CID 121145445
methyl N-[2-(furan-2-yl)-2-methoxyethyl]carbamate (PubChem CID 121145445) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl N-[2-(furan-2-yl)-2-methoxyethyl]carbamate.
| Compound Name | methyl N-[2-(furan-2-yl)-2-methoxyethyl]carbamate |
|---|---|
| PubChem CID | 121145445 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl N-[2-(furan-2-yl)-2-methoxyethyl]carbamate |
| SMILES | COC(=O)NCC(OC)c1ccco1 |
| InChI | InChI=1S/C9H13NO4/c1-12-8(6-10-9(11)13-2)7-4-3-5-14-7/h3-5,8H,6H2,1-2H3,(H,10,11) |
| InChIKey | DYFROMDNZZQFHN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |