C14H13F2NO3 — CID 121145483
2,6-difluoro-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide (PubChem CID 121145483) has the molecular formula C14H13F2NO3 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide |
|---|---|
| PubChem CID | 121145483 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide |
| SMILES | COC(CNC(=O)c1c(F)cccc1F)c1ccco1 |
| InChI | InChI=1S/C14H13F2NO3/c1-19-12(11-6-3-7-20-11)8-17-14(18)13-9(15)4-2-5-10(13)16/h2-7,12H,8H2,1H3,(H,17,18) |
| InChIKey | FPUUPTUSIDAZOG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |