C20H17F2NO5S — CID 20962895
2,6-difluoro-N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]benzamide (PubChem CID 20962895) has the molecular formula C20H17F2NO5S and a molecular weight of 421.42 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 20962895 |
| Molecular Formula | C20H17F2NO5S |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)C(CNC(=O)c2c(F)cccc2F)c2ccco2)cc1 |
| InChI | InChI=1S/C20H17F2NO5S/c1-27-13-7-9-14(10-8-13)29(25,26)18(17-6-3-11-28-17)12-23-20(24)19-15(21)4-2-5-16(19)22/h2-11,18H,12H2,1H3,(H,23,24) |
| InChIKey | PZFYAYCUOXXCRF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |