C24H29NO5S — CID 26792762
N-[(2R)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]adamantane-1-carboxamide (PubChem CID 26792762) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]adamantane-1-carboxamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 26792762 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CNC(=O)C23CC4CC(CC(C4)C2)C3)c2ccco2)cc1 |
| InChI | InChI=1S/C24H29NO5S/c1-29-19-4-6-20(7-5-19)31(27,28)22(21-3-2-8-30-21)15-25-23(26)24-12-16-9-17(13-24)11-18(10-16)14-24/h2-8,16-18,22H,9-15H2,1H3,(H,25,26)/t16?,17?,18?,22-,24?/m1/s1 |
| InChIKey | YWJDEGGIQGCSAU-YFZSMNHSSA-N |
| XLogP | 4.14 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |