C18H16BrNO6S — CID 26792715
5-bromo-N-[(2S)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]furan-2-carboxamide (PubChem CID 26792715) has the molecular formula C18H16BrNO6S and a molecular weight of 454.30 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26792715 |
| Molecular Formula | C18H16BrNO6S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]furan-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)[C@@H](CNC(=O)c2ccc(Br)o2)c2ccco2)cc1 |
| InChI | InChI=1S/C18H16BrNO6S/c1-24-12-4-6-13(7-5-12)27(22,23)16(14-3-2-10-25-14)11-20-18(21)15-8-9-17(19)26-15/h2-10,16H,11H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | MHYVTELSQUIQIO-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |