C17H19NO5S — CID 110315102
N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]cyclopropanecarboxamide (PubChem CID 110315102) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110315102 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(S(=O)(=O)C(CNC(=O)C2CC2)c2ccco2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-22-13-6-8-14(9-7-13)24(20,21)16(15-3-2-10-23-15)11-18-17(19)12-4-5-12/h2-3,6-10,12,16H,4-5,11H2,1H3,(H,18,19) |
| InChIKey | ZVWLNHJTNNPRNE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |