C21H21NO5S — CID 7268107
N-[(2S)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3-methoxybenzamide (PubChem CID 7268107) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3-methoxybenzamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 7268107 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC[C@@H](c2ccco2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H21NO5S/c1-15-8-10-18(11-9-15)28(24,25)20(19-7-4-12-27-19)14-22-21(23)16-5-3-6-17(13-16)26-2/h3-13,20H,14H2,1-2H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | JSZSZEKPZOLFRK-FQEVSTJZSA-N |
| XLogP | 3.54 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |