C23H25NO7S — CID 22584481
N-[2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3,4,5-trimethoxybenzamide (PubChem CID 22584481) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 22584481 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2ccco2)S(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO7S/c1-15-7-9-17(10-8-15)32(26,27)21(18-6-5-11-31-18)14-24-23(25)16-12-19(28-2)22(30-4)20(13-16)29-3/h5-13,21H,14H2,1-4H3,(H,24,25) |
| InChIKey | UQAFBANPUDBJMQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |