C15H20N2O6S2 — CID 110315122
2-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)sulfonylethyl]furan (PubChem CID 110315122) has the molecular formula C15H20N2O6S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)sulfonylethyl]furan.
| Compound Name | 2-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)sulfonylethyl]furan |
|---|---|
| PubChem CID | 110315122 |
| Molecular Formula | C15H20N2O6S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[2-(dimethylsulfamoylamino)-1-(4-methoxyphenyl)sulfonylethyl]furan |
| SMILES | COc1ccc(S(=O)(=O)C(CNS(=O)(=O)N(C)C)c2ccco2)cc1 |
| InChI | InChI=1S/C15H20N2O6S2/c1-17(2)25(20,21)16-11-15(14-5-4-10-23-14)24(18,19)13-8-6-12(22-3)7-9-13/h4-10,15-16H,11H2,1-3H3 |
| InChIKey | BHSOGIHBAYGZFN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |