C14H17NO5S2 — CID 7268396
N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]methanesulfonamide (PubChem CID 7268396) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]methanesulfonamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 7268396 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]methanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CNS(C)(=O)=O)c2ccco2)cc1 |
| InChI | InChI=1S/C14H17NO5S2/c1-11-5-7-12(8-6-11)22(18,19)14(10-15-21(2,16)17)13-4-3-9-20-13/h3-9,14-15H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | UKZBDSLLJSHLPQ-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |