C14H16FNO5S2 — CID 7268411
N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]ethanesulfonamide (PubChem CID 7268411) has the molecular formula C14H16FNO5S2 and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 7268411 |
| Molecular Formula | C14H16FNO5S2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H](c1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNO5S2/c1-2-22(17,18)16-10-14(13-4-3-9-21-13)23(19,20)12-7-5-11(15)6-8-12/h3-9,14,16H,2,10H2,1H3/t14-/m0/s1 |
| InChIKey | DSHTZAQHKZWMMK-AWEZNQCLSA-N |
| XLogP | 1.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |