C17H21FN2O4S — CID 110315018
1,1-diethyl-3-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]urea (PubChem CID 110315018) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]urea.
| Compound Name | 1,1-diethyl-3-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 110315018 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1,1-diethyl-3-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]urea |
| SMILES | CCN(CC)C(=O)NCC(c1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O4S/c1-3-20(4-2)17(21)19-12-16(15-6-5-11-24-15)25(22,23)14-9-7-13(18)8-10-14/h5-11,16H,3-4,12H2,1-2H3,(H,19,21) |
| InChIKey | XPRQDACIAHRUOS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |