C13H14FNO5S2 — CID 18574141
N-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]methanesulfonamide (PubChem CID 18574141) has the molecular formula C13H14FNO5S2 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 18574141 |
| Molecular Formula | C13H14FNO5S2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(c1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO5S2/c1-21(16,17)15-9-13(12-3-2-8-20-12)22(18,19)11-6-4-10(14)5-7-11/h2-8,13,15H,9H2,1H3 |
| InChIKey | KRPZTDZYSUUIRD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |