C19H16FNO5S — CID 7268237
phenyl N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]carbamate (PubChem CID 7268237) has the molecular formula C19H16FNO5S and a molecular weight of 389.40 g/mol. Its IUPAC name is phenyl N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]carbamate.
| Compound Name | phenyl N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 7268237 |
| Molecular Formula | C19H16FNO5S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | phenyl N-[(2S)-2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]carbamate |
| SMILES | O=C(NC[C@@H](c1ccco1)S(=O)(=O)c1ccc(F)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H16FNO5S/c20-14-8-10-16(11-9-14)27(23,24)18(17-7-4-12-25-17)13-21-19(22)26-15-5-2-1-3-6-15/h1-12,18H,13H2,(H,21,22)/t18-/m0/s1 |
| InChIKey | ZELFCBOCZKXZEI-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |