C17H21NO7S2 — CID 9125346
methyl 3-[[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]sulfamoyl]propanoate (PubChem CID 9125346) has the molecular formula C17H21NO7S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 3-[[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]sulfamoyl]propanoate.
| Compound Name | methyl 3-[[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]sulfamoyl]propanoate |
|---|---|
| PubChem CID | 9125346 |
| Molecular Formula | C17H21NO7S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | methyl 3-[[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]sulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)NC[C@H](c1ccco1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO7S2/c1-13-5-7-14(8-6-13)27(22,23)16(15-4-3-10-25-15)12-18-26(20,21)11-9-17(19)24-2/h3-8,10,16,18H,9,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | WCZDUFOLQSSLBU-MRXNPFEDSA-N |
| XLogP | 1.59 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |