C21H20ClNO5S — CID 40774896
2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]acetamide (PubChem CID 40774896) has the molecular formula C21H20ClNO5S and a molecular weight of 433.91 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 40774896 |
| Molecular Formula | C21H20ClNO5S |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CNC(=O)COc2ccc(Cl)cc2)c2ccco2)cc1 |
| InChI | InChI=1S/C21H20ClNO5S/c1-15-4-10-18(11-5-15)29(25,26)20(19-3-2-12-27-19)13-23-21(24)14-28-17-8-6-16(22)7-9-17/h2-12,20H,13-14H2,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | UGQVPCVKMGMWPH-HXUWFJFHSA-N |
| XLogP | 3.95 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |