C17H20ClNO4S — CID 9161526
2-chloro-N-[(2S)-2-(furan-2-yl)-2-(4-propan-2-ylphenyl)sulfonylethyl]acetamide (PubChem CID 9161526) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-(furan-2-yl)-2-(4-propan-2-ylphenyl)sulfonylethyl]acetamide.
| Compound Name | 2-chloro-N-[(2S)-2-(furan-2-yl)-2-(4-propan-2-ylphenyl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 9161526 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-chloro-N-[(2S)-2-(furan-2-yl)-2-(4-propan-2-ylphenyl)sulfonylethyl]acetamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)[C@@H](CNC(=O)CCl)c2ccco2)cc1 |
| InChI | InChI=1S/C17H20ClNO4S/c1-12(2)13-5-7-14(8-6-13)24(21,22)16(11-19-17(20)10-18)15-4-3-9-23-15/h3-9,12,16H,10-11H2,1-2H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | GVNILBBSWCDLJJ-INIZCTEOSA-N |
| XLogP | 3.27 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|