C15H14ClNO6S — CID 9160281
N-[(2S)-2-(1,3-benzodioxol-5-ylsulfonyl)-2-(furan-2-yl)ethyl]-2-chloroacetamide (PubChem CID 9160281) has the molecular formula C15H14ClNO6S and a molecular weight of 371.80 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-ylsulfonyl)-2-(furan-2-yl)ethyl]-2-chloroacetamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-ylsulfonyl)-2-(furan-2-yl)ethyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 9160281 |
| Molecular Formula | C15H14ClNO6S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-ylsulfonyl)-2-(furan-2-yl)ethyl]-2-chloroacetamide |
| SMILES | O=C(CCl)NC[C@@H](c1ccco1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14ClNO6S/c16-7-15(18)17-8-14(12-2-1-5-21-12)24(19,20)10-3-4-11-13(6-10)23-9-22-11/h1-6,14H,7-9H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | VOAXXMGENWVOIU-AWEZNQCLSA-N |
| XLogP | 1.88 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|