C18H22N2O5S — CID 9161190
N'-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-ethyloxamide (PubChem CID 9161190) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N'-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-ethyloxamide.
| Compound Name | N'-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-ethyloxamide |
|---|---|
| PubChem CID | 9161190 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N'-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)NC[C@@H](c1ccco1)S(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-4-19-17(21)18(22)20-11-16(15-6-5-9-25-15)26(23,24)14-8-7-12(2)13(3)10-14/h5-10,16H,4,11H2,1-3H3,(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | GVLHLSZUFFAAAV-INIZCTEOSA-N |
| XLogP | 1.66 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|