C20H18FNO4S — CID 26792820
N-[(2R)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]benzamide (PubChem CID 26792820) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]benzamide.
| Compound Name | N-[(2R)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 26792820 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[(2R)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]benzamide |
| SMILES | Cc1cc(S(=O)(=O)[C@H](CNC(=O)c2ccccc2)c2ccco2)ccc1F |
| InChI | InChI=1S/C20H18FNO4S/c1-14-12-16(9-10-17(14)21)27(24,25)19(18-8-5-11-26-18)13-22-20(23)15-6-3-2-4-7-15/h2-12,19H,13H2,1H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | FQKLQTFGMJTUCS-LJQANCHMSA-N |
| XLogP | 3.67 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |