C22H21FN2O8S — CID 41128885
N-[(2S)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 41128885) has the molecular formula C22H21FN2O8S and a molecular weight of 492.48 g/mol. Its IUPAC name is N-[(2S)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[(2S)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 41128885 |
| Molecular Formula | C22H21FN2O8S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-[(2S)-2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC[C@@H](c2ccco2)S(=O)(=O)c2ccc(F)c(C)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H21FN2O8S/c1-13-9-14(6-7-16(13)23)34(29,30)21(18-5-4-8-33-18)12-24-22(26)15-10-19(31-2)20(32-3)11-17(15)25(27)28/h4-11,21H,12H2,1-3H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | DHVWESVNXOKHTP-NRFANRHFSA-N |
| XLogP | 3.60 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|