C21H27N3O6 — CID 55451253
4-ethoxy-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methoxy-2-nitrobenzamide (PubChem CID 55451253) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methoxy-2-nitrobenzamide.
| Compound Name | 4-ethoxy-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55451253 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-ethoxy-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)NCC(c2ccco2)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C21H27N3O6/c1-3-29-20-13-16(24(26)27)15(12-19(20)28-2)21(25)22-14-17(18-8-7-11-30-18)23-9-5-4-6-10-23/h7-8,11-13,17H,3-6,9-10,14H2,1-2H3,(H,22,25) |
| InChIKey | UNAUKVSDNCEXBQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|