C14H22ClN3O5 — CID 119997363
N-(3-amino-2-methylpropyl)-5-ethoxy-4-methoxy-2-nitrobenzamide;hydrochloride (PubChem CID 119997363) has the molecular formula C14H22ClN3O5 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-5-ethoxy-4-methoxy-2-nitrobenzamide;hydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-5-ethoxy-4-methoxy-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119997363 |
| Molecular Formula | C14H22ClN3O5 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-5-ethoxy-4-methoxy-2-nitrobenzamide;hydrochloride |
| SMILES | CCOc1cc(C(=O)NCC(C)CN)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C14H21N3O5.ClH/c1-4-22-13-5-10(14(18)16-8-9(2)7-15)11(17(19)20)6-12(13)21-3;/h5-6,9H,4,7-8,15H2,1-3H3,(H,16,18);1H |
| InChIKey | VJDGUILZNQNWGF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|