C15H22ClN3O6 — CID 120947856
5-ethoxy-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-2-nitrobenzamide;hydrochloride (PubChem CID 120947856) has the molecular formula C15H22ClN3O6 and a molecular weight of 375.81 g/mol. Its IUPAC name is 5-ethoxy-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-2-nitrobenzamide;hydrochloride.
| Compound Name | 5-ethoxy-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120947856 |
| Molecular Formula | C15H22ClN3O6 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 5-ethoxy-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-2-nitrobenzamide;hydrochloride |
| SMILES | CCOc1cc(C(=O)NCC2CNCC2O)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C15H21N3O6.ClH/c1-3-24-14-4-10(11(18(21)22)5-13(14)23-2)15(20)17-7-9-6-16-8-12(9)19;/h4-5,9,12,16,19H,3,6-8H2,1-2H3,(H,17,20);1H |
| InChIKey | SJBQOXROYLPIMW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|