C21H28N2O5 — CID 9047126
N-(1-adamantylmethyl)-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 9047126) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-(1-adamantylmethyl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 9047126 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-(1-adamantylmethyl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)NCC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H28N2O5/c1-3-28-19-7-16(17(23(25)26)8-18(19)27-2)20(24)22-12-21-9-13-4-14(10-21)6-15(5-13)11-21/h7-8,13-15H,3-6,9-12H2,1-2H3,(H,22,24) |
| InChIKey | LTRYNMPOBNGGMX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|