C12H18ClN3O4 — CID 119997019
N-(3-amino-2-methylpropyl)-3-methoxy-4-nitrobenzamide;hydrochloride (PubChem CID 119997019) has the molecular formula C12H18ClN3O4 and a molecular weight of 303.75 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-3-methoxy-4-nitrobenzamide;hydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-3-methoxy-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119997019 |
| Molecular Formula | C12H18ClN3O4 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-3-methoxy-4-nitrobenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NCC(C)CN)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H17N3O4.ClH/c1-8(6-13)7-14-12(16)9-3-4-10(15(17)18)11(5-9)19-2;/h3-5,8H,6-7,13H2,1-2H3,(H,14,16);1H |
| InChIKey | UUHDEBBQAZSQTA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|