C15H24ClN3O6 — CID 119496680
N-(3-aminobutyl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide;hydrochloride (PubChem CID 119496680) has the molecular formula C15H24ClN3O6 and a molecular weight of 377.83 g/mol. Its IUPAC name is N-(3-aminobutyl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119496680 |
| Molecular Formula | C15H24ClN3O6 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(3-aminobutyl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide;hydrochloride |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NCCC(C)N)cc1OC.Cl |
| InChI | InChI=1S/C15H23N3O6.ClH/c1-10(16)4-5-17-15(19)11-8-13(23-3)14(24-7-6-22-2)9-12(11)18(20)21;/h8-10H,4-7,16H2,1-3H3,(H,17,19);1H |
| InChIKey | FBNKTSAISHERHA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|