C19H22N4O8 — CID 46520903
5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 46520903) has the molecular formula C19H22N4O8 and a molecular weight of 434.41 g/mol. Its IUPAC name is 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 46520903 |
| Molecular Formula | C19H22N4O8 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NCCNc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H22N4O8/c1-29-9-10-31-18-12-16(23(27)28)13(11-17(18)30-2)19(24)21-8-7-20-14-5-3-4-6-15(14)22(25)26/h3-6,11-12,20H,7-10H2,1-2H3,(H,21,24) |
| InChIKey | DSZGAMUCUQWOHU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|